DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P99999
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P99999 | Download | Predicted | P99999_nD1 | Cytochrome c-like | |
| 1J3S | Predicted | e1j3sA1 | |||
| 2N3Y | Predicted | e2n3yA1 | |||
| 2N9I | Predicted | e2n9iA1 | |||
| 2N9J | Predicted | e2n9jA1 | |||
| 3NWV | Predicted | e3nwvA1 e3nwvB1 e3nwvC1 e3nwvD1 | |||
| 3ZCF | Predicted | e3zcfA1 e3zcfB1 e3zcfC1 e3zcfD1 | |||
| 3ZOO | Predicted | e3zooA1 e3zooB1 e3zooC1 e3zooD1 | |||
| 5EXQ | Predicted | e5exqA1 e5exqB1 | |||
| 5O10 | Predicted | e5o10A1 e5o10B1 | |||
| 5TY3 | Predicted | e5ty3A1 e5ty3B1 | |||
| 6DUJ | Predicted | e6dujA1 e6dujC1 | |||
| 6ECJ | Predicted | e6ecjA1 e6ecjB1 e6ecjC1 e6ecjD1 e6ecjE1 e6ecjF1 e6ecjG1 e6ecjH1 |