DB03496 Alvocidib
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl
Small molecule PDB accession : CPB
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein Q00534
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q00534 | Download | Predicted | Q00534_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
1BI7 | Predicted | e1bi7A1 | |||
1BI8 | Predicted | e1bi8C1 e1bi8A1 | |||
1BLX | Predicted | e1blxA1 | |||
1G3N | Predicted | e1g3nA1 e1g3nE1 | |||
1JOW | Predicted | e1jowB1 | |||
1XO2 | Predicted | e1xo2B1 | |||
2EUF | Predicted | e2eufB1 | |||
2F2C | Predicted | e2f2cB1 | |||
3NUP | Predicted | e3nupA1 | |||
3NUX | Predicted | e3nuxA1 | |||
4AUA | Predicted | e4auaA2 | |||
4EZ5 | Predicted | e4ez5A1 | |||
4TTH | Predicted | e4tthB1 | |||
5L2I | Predicted | e5l2iA1 | |||
5L2S | Predicted | e5l2sA1 | |||
5L2T | Predicted | e5l2tA1 |