DB01117 Atovaquone
InChI Key: KUCQYCKVKVOKAY-CTYIDZIISA-N
SMILES: OC1=C([C@H]2CC[C@@H](CC2)C2=CC=C(Cl)C=C2)C(=O)C2=CC=CC=C2C1=O
Small molecule PDB accession : AOQ
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q02127
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q02127 | Download | Predicted | Q02127_nD1 | TIM beta/alpha-barrel | |
1D3G | Predicted | e1d3gA1 | |||
1D3H | Predicted | e1d3hA1 | |||
2B0M | Predicted | e2b0mA1 | |||
2BXV | Predicted | e2bxvA1 | |||
2FPT | Predicted | e2fptA1 | |||
2FPV | Predicted | e2fpvA1 | |||
2FPY | Predicted | e2fpyA1 | |||
2FQI | Predicted | e2fqiA1 | |||
2PRH | Predicted | e2prhA1 | |||
2PRL | Predicted | e2prlA1 | |||
2PRM | Predicted | e2prmA1 | |||
2WV8 | Predicted | e2wv8A1 | |||
3F1Q | Predicted | e3f1qA1 | |||
3FJ6 | Predicted | e3fj6A1 | |||
3FJL | Predicted | e3fjlA1 | |||
3G0U | Predicted | e3g0uA1 | |||
3G0X | Predicted | e3g0xA1 | |||
3KVJ | Predicted | e3kvjA1 | |||
3KVK | Predicted | e3kvkA1 | |||
3KVL | Predicted | e3kvlA1 | |||
3KVM | Predicted | e3kvmA1 | |||
3U2O | Predicted | e3u2oA1 | |||
3W7R | Predicted | e3w7rA1 | |||
3ZWS | Predicted | e3zwsA1 | |||
3ZWT | Predicted | e3zwtA1 | |||
4IGH | Predicted | e4ighA1 | |||
4JGD | Predicted | e4jgdA1 | |||
4JS3 | Predicted | e4js3A1 | |||
4JTS | Predicted | e4jtsA1 | |||
4JTT | Predicted | e4jttA1 | |||
4JTU | Predicted | e4jtuA1 | |||
4LS0 | Predicted | e4ls0A1 | |||
4LS1 | Predicted | e4ls1A1 | |||
4LS2 | Predicted | e4ls2A1 | |||
4OQV | Predicted | e4oqvA1 | |||
4RK8 | Predicted | e4rk8A1 | |||
4RKA | Predicted | e4rkaA1 | |||
4RLI | Predicted | e4rliA1 | |||
4RR4 | Predicted | e4rr4A1 | |||
4YLW | Predicted | e4ylwA1 | |||
4ZL1 | Predicted | e4zl1A1 | |||
4ZMG | Predicted | e4zmgA1 | |||
5H2Z | Predicted | e5h2zA1 | |||
5H73 | Predicted | e5h73A1 | |||
5HIN | Predicted | e5hinA1 | |||
5HQE | Predicted | e5hqeA1 | |||
5K9C | Predicted | e5k9cA1 | |||
5K9D | Predicted | e5k9dA1 | |||
5MUT | Predicted | e5mutA1 | |||
5MVC | Predicted | e5mvcA1 | |||
5MVD | Predicted | e5mvdA1 | |||
5ZF4 | Predicted | e5zf4A1 | |||
5ZF7 | Predicted | e5zf7A1 | |||
5ZF8 | Predicted | e5zf8A1 | |||
5ZF9 | Predicted | e5zf9A1 | |||
5ZFA | Predicted | e5zfaA1 | |||
5ZFB | Predicted | e5zfbA1 | |||
6CJF | Predicted | e6cjfA1 e6cjfB1 | |||
6CJG | Predicted | e6cjgA1 | |||
6ET4 | Predicted | e6et4A1 | |||
6FMD | Predicted | e6fmdA1 | |||
6GK0 | Predicted | e6gk0A1 | |||
6IDJ | Predicted | e6idjA1 | |||
6J3B | Predicted | e6j3bA1 | |||
6J3C | Predicted | e6j3cA1 | |||
6OC0 | Predicted | e6oc0A1 | |||
6OC1 | Predicted | e6oc1A1 | |||
6QU7 | Predicted | e6qu7A1 | |||
6SYP | Predicted | e6sypAAA1 |