DB06481 Manitimus
InChI Key: IRELROQHIPLASX-SEYXRHQNSA-N
SMILES: O\C(CCC#C)=C(\C#N)C(=O)NC1=CC=C(C=C1)C(F)(F)F
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein Q02127
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q02127 | Download | Predicted | Q02127_nD1 | TIM beta/alpha-barrel | |
| 1D3G | Predicted | e1d3gA1 | |||
| 1D3H | Predicted | e1d3hA1 | |||
| 2B0M | Predicted | e2b0mA1 | |||
| 2BXV | Predicted | e2bxvA1 | |||
| 2FPT | Predicted | e2fptA1 | |||
| 2FPV | Predicted | e2fpvA1 | |||
| 2FPY | Predicted | e2fpyA1 | |||
| 2FQI | Predicted | e2fqiA1 | |||
| 2PRH | Predicted | e2prhA1 | |||
| 2PRL | Predicted | e2prlA1 | |||
| 2PRM | Predicted | e2prmA1 | |||
| 2WV8 | Predicted | e2wv8A1 | |||
| 3F1Q | Predicted | e3f1qA1 | |||
| 3FJ6 | Predicted | e3fj6A1 | |||
| 3FJL | Predicted | e3fjlA1 | |||
| 3G0U | Predicted | e3g0uA1 | |||
| 3G0X | Predicted | e3g0xA1 | |||
| 3KVJ | Predicted | e3kvjA1 | |||
| 3KVK | Predicted | e3kvkA1 | |||
| 3KVL | Predicted | e3kvlA1 | |||
| 3KVM | Predicted | e3kvmA1 | |||
| 3U2O | Predicted | e3u2oA1 | |||
| 3W7R | Predicted | e3w7rA1 | |||
| 3ZWS | Predicted | e3zwsA1 | |||
| 3ZWT | Predicted | e3zwtA1 | |||
| 4IGH | Predicted | e4ighA1 | |||
| 4JGD | Predicted | e4jgdA1 | |||
| 4JS3 | Predicted | e4js3A1 | |||
| 4JTS | Predicted | e4jtsA1 | |||
| 4JTT | Predicted | e4jttA1 | |||
| 4JTU | Predicted | e4jtuA1 | |||
| 4LS0 | Predicted | e4ls0A1 | |||
| 4LS1 | Predicted | e4ls1A1 | |||
| 4LS2 | Predicted | e4ls2A1 | |||
| 4OQV | Predicted | e4oqvA1 | |||
| 4RK8 | Predicted | e4rk8A1 | |||
| 4RKA | Predicted | e4rkaA1 | |||
| 4RLI | Predicted | e4rliA1 | |||
| 4RR4 | Predicted | e4rr4A1 | |||
| 4YLW | Predicted | e4ylwA1 | |||
| 4ZL1 | Predicted | e4zl1A1 | |||
| 4ZMG | Predicted | e4zmgA1 | |||
| 5H2Z | Predicted | e5h2zA1 | |||
| 5H73 | Predicted | e5h73A1 | |||
| 5HIN | Predicted | e5hinA1 | |||
| 5HQE | Predicted | e5hqeA1 | |||
| 5K9C | Predicted | e5k9cA1 | |||
| 5K9D | Predicted | e5k9dA1 | |||
| 5MUT | Predicted | e5mutA1 | |||
| 5MVC | Predicted | e5mvcA1 | |||
| 5MVD | Predicted | e5mvdA1 | |||
| 5ZF4 | Predicted | e5zf4A1 | |||
| 5ZF7 | Predicted | e5zf7A1 | |||
| 5ZF8 | Predicted | e5zf8A1 | |||
| 5ZF9 | Predicted | e5zf9A1 | |||
| 5ZFA | Predicted | e5zfaA1 | |||
| 5ZFB | Predicted | e5zfbA1 | |||
| 6CJF | Predicted | e6cjfA1 e6cjfB1 | |||
| 6CJG | Predicted | e6cjgA1 | |||
| 6ET4 | Predicted | e6et4A1 | |||
| 6FMD | Predicted | e6fmdA1 | |||
| 6GK0 | Predicted | e6gk0A1 | |||
| 6IDJ | Predicted | e6idjA1 | |||
| 6J3B | Predicted | e6j3bA1 | |||
| 6J3C | Predicted | e6j3cA1 | |||
| 6OC0 | Predicted | e6oc0A1 | |||
| 6OC1 | Predicted | e6oc1A1 | |||
| 6QU7 | Predicted | e6qu7A1 | |||
| 6SYP | Predicted | e6sypAAA1 |