DB08901 Ponatinib
InChI Key: PHXJVRSECIGDHY-UHFFFAOYSA-N
SMILES: CN1CCN(CC2=CC=C(NC(=O)C3=CC(C#CC4=CN=C5C=CC=NN45)=C(C)C=C3)C=C2C(F)(F)F)CC1
Small molecule PDB accession : 0LI
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q02763
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q02763 | Download | Predicted | Q02763_nD11 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 1FVR | Predicted | e1fvrA1 e1fvrB1 | |||
| 2GY5 | Predicted | e2gy5A1 e2gy5A2 e2gy5A3 e2gy5A6 e2gy5A5 e2gy5A4 | |||
| 2GY7 | Predicted | e2gy7B2 e2gy7B1 e2gy7B7 e2gy7B5 e2gy7B6 e2gy7B3 | |||
| 2OO8 | Predicted | e2oo8X1 | |||
| 2OSC | Predicted | e2oscA2 | |||
| 2P4I | Predicted | e2p4iB1 e2p4iA1 | |||
| 2WQB | Predicted | e2wqbA1 | |||
| 3L8P | Predicted | e3l8pA1 | |||
| 4K0V | Predicted | e4k0vA1 e4k0vA7 e4k0vA3 e4k0vA2 e4k0vA5 e4k0vA4 e4k0vA6 | |||
| 4X3J | Predicted | e4x3jA1 | |||
| 5MYA | Predicted | e5myaA2 e5myaB1 e5myaA3 e5myaA1 e5myaB2 | |||
| 5MYB | Predicted | e5mybA1 e5mybB1 e5mybA2 e5mybB2 | |||
| 5UTK | Predicted | e5utkA2 e5utkA1 e5utkB2 e5utkB3 e5utkA3 e5utkB1 | |||
| 6MWE | Predicted | e6mweA1 e6mweB1 |