DB00171 ATP
InChI Key: ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES: NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Small molecule PDB accession : ATP
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein Q04771
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q04771 | Download | Predicted | Q04771_nD3 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 3H9R | Predicted | e3h9rA1 | |||
| 3MTF | Predicted | e3mtfA1 e3mtfB1 | |||
| 3OOM | Predicted | e3oomA1 | |||
| 3Q4U | Predicted | e3q4uA1 e3q4uB1 e3q4uC1 e3q4uD1 | |||
| 4BGG | Predicted | e4bggA1 e4bggB2 e4bggD2 e4bggC2 | |||
| 4C02 | Predicted | e4c02A1 | |||
| 4DYM | Predicted | e4dymA1 | |||
| 5OXG | Predicted | e5oxgA1 e5oxgB1 e5oxgC1 e5oxgD1 | |||
| 5OY6 | Predicted | e5oy6B1 e5oy6A1 e5oy6C1 e5oy6D1 | |||
| 6ACR | Predicted | e6acrA1 e6acrB1 | |||
| 6EIX | Predicted | e6eixA1 | |||
| 6GI6 | Predicted | e6gi6A1 | |||
| 6GIN | Predicted | e6ginA1 e6ginB1 | |||
| 6GIP | Predicted | e6gipA1 | |||
| 6I1S | Predicted | e6i1sA1 | |||
| 6SRH | Predicted | e6srhA1 e6srhB1 | |||
| 6SZM | Predicted | e6szmA1 e6szmB1 | |||
| 6T6D | Predicted | e6t6dB1 e6t6dD1 e6t6dA1 e6t6dC1 | |||
| 6T8N | Predicted | e6t8nA1 e6t8nB1 | |||
| 6TN8 | Predicted | e6tn8A1 |