DB03467 Naringenin
InChI Key: FTVWIRXFELQLPI-ZDUSSCGKSA-N
SMILES: [H][C@]1(CC(=O)C2=C(O1)C=C(O)C=C2O)C1=CC=C(O)C=C1
Small molecule PDB accession : NAR
Drug action: antagonist
List of PDB structures and/or AlphaFold models with target protein Q04828
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q04828 | Download | Predicted | Q04828_nD1 | TIM beta/alpha-barrel | |
| 1MRQ | Predicted | e1mrqA1 | |||
| 3C3U | Predicted | e3c3uA1 | |||
| 3GUG | Predicted | e3gugA1 | |||
| 3NTY | Predicted | e3ntyA1 | |||
| 4YVP | Predicted | e4yvpA1 e4yvpB1 | |||
| 6A7A | Predicted | e6a7aA1 | |||
| 6IJX | Predicted | e6ijxA1 |