DB15035 Zanubrutinib
InChI Key: RNOAOAWBMHREKO-QFIPXVFZSA-N
SMILES: NC(=O)C1=C2NCC[C@@H](C3CCN(CC3)C(=O)C=C)N2N=C1C1=CC=C(OC2=CC=CC=C2)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q06187
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q06187 | Download | Predicted | Q06187_nD2 Q06187_nD5 Q06187_nD1 | Btk/CHORD zinc fingers Protein kinase/SAICAR synthase/ATP-grasp PH domain-like | |
1AWW | Predicted | e1awwA1 | |||
1AWX | Predicted | e1awxA1 | |||
1B55 | Predicted | e1b55A1 e1b55B1 e1b55A2 e1b55B2 | |||
1BTK | Predicted | e1btkA1 e1btkB1 e1btkA2 e1btkB2 | |||
1BWN | Predicted | e1bwnB1 e1bwnA1 e1bwnB2 e1bwnA2 | |||
1K2P | Predicted | e1k2pB1 e1k2pA1 | |||
1QLY | Predicted | e1qlyA1 | |||
2GE9 | Predicted | e2ge9A1 | |||
2Z0P | Predicted | e2z0pB1 e2z0pD1 e2z0pA1 e2z0pC1 e2z0pC2 e2z0pB2 e2z0pD2 e2z0pA2 | |||
3GEN | Predicted | e3genA1 | |||
3K54 | Predicted | e3k54A1 | |||
3OCS | Predicted | e3ocsA1 | |||
3OCT | Predicted | e3octA1 | |||
3P08 | Predicted | e3p08A1 e3p08B1 | |||
3PIX | Predicted | e3pixA1 | |||
3PIY | Predicted | e3piyA1 | |||
3PIZ | Predicted | e3pizA1 | |||
3PJ1 | Predicted | e3pj1A1 | |||
3PJ2 | Predicted | e3pj2A1 | |||
3PJ3 | Predicted | e3pj3A1 | |||
4NWM | Predicted | e4nwmA1 e4nwmB1 | |||
4OT5 | Predicted | e4ot5A1 | |||
4OT6 | Predicted | e4ot6A1 | |||
4OTF | Predicted | e4otfA1 | |||
4OTQ | Predicted | e4otqA1 | |||
4OTR | Predicted | e4otrA1 | |||
4RFY | Predicted | e4rfyA1 | |||
4RFZ | Predicted | e4rfzA1 | |||
4RG0 | Predicted | e4rg0A1 | |||
4RX5 | Predicted | e4rx5A1 | |||
4YHF | Predicted | e4yhfB1 e4yhfA1 | |||
4Z3V | Predicted | e4z3vA1 | |||
4ZLY | Predicted | e4zlyA1 | |||
4ZLZ | Predicted | e4zlzA1 | |||
5BPY | Predicted | e5bpyA1 e5bpyB1 | |||
5BQ0 | Predicted | e5bq0A1 | |||
5FBN | Predicted | e5fbnC1 e5fbnD1 | |||
5FBO | Predicted | e5fboA1 | |||
5J87 | Predicted | e5j87B1 e5j87A1 e5j87C1 e5j87D1 | |||
5JRS | Predicted | e5jrsA1 e5jrsB1 | |||
5KUP | Predicted | e5kupA1 | |||
5P9F | Predicted | e5p9fA1 | |||
5P9G | Predicted | e5p9gA1 | |||
5P9H | Predicted | e5p9hA1 | |||
5P9I | Predicted | e5p9iA1 | |||
5P9J | Predicted | e5p9jA1 | |||
5P9K | Predicted | e5p9kA1 | |||
5P9L | Predicted | e5p9lA1 | |||
5P9M | Predicted | e5p9mA1 | |||
5T18 | Predicted | e5t18A1 | |||
5U9D | Predicted | e5u9dA1 | |||
5VFI | Predicted | e5vfiA1 | |||
5VGO | Predicted | e5vgoA1 | |||
5XYZ | Predicted | e5xyzA1 e5xyzB1 | |||
5ZZ4 | Predicted | e5zz4B1 e5zz4A1 e5zz4C1 e5zz4E1 e5zz4D1 e5zz4F1 | |||
6AUA | Predicted | e6auaA1 | |||
6AUB | Predicted | e6aubA1 | |||
6BIK | Predicted | e6bikA1 | |||
6BKE | Predicted | e6bkeA1 | |||
6BKH | Predicted | e6bkhA1 | |||
6BKW | Predicted | e6bkwA1 | |||
6BLN | Predicted | e6blnA1 | |||
6DI0 | Predicted | e6di0A1 | |||
6DI1 | Predicted | e6di1A1 | |||
6DI3 | Predicted | e6di3A1 | |||
6DI5 | Predicted | e6di5A1 | |||
6DI9 | Predicted | e6di9A1 | |||
6E4F | Predicted | e6e4fA1 | |||
6EP9 | Predicted | e6ep9A1 | |||
6HRP | Predicted | e6hrpA1 | |||
6HRT | Predicted | e6hrtA1 | |||
6J6M | Predicted | e6j6mA1 | |||
6N9P | Predicted | e6n9pA1 | |||
6NFH | Predicted | e6nfhA1 | |||
6NFI | Predicted | e6nfiA1 | |||
6NZM | Predicted | e6nzmA1 e6nzmD1 | |||
6O8I | Predicted | e6o8iA1 | |||
6OMU | Predicted | e6omuA1 | |||
6S90 | Predicted | e6s90A1 e6s90B1 |