DB12756 TAK-901
InChI Key: WKDACQVEJIVHMZ-UHFFFAOYSA-N
SMILES: CCS(=O)(=O)C1=CC=CC(=C1)C1=CC(C(=O)NC2CCN(C)CC2)=C(C)C2=C1C1=C(N2)N=CC(C)=C1
Small molecule PDB accession : n/a
Drug action: activator
List of PDB structures and/or AlphaFold models with target protein Q07812
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q07812 | Download | Predicted | Q07812_nD1 | Toxins' membrane translocation domains | |
| 1F16 | Predicted | e1f16A1 | |||
| 2K7W | Predicted | e2k7wA1 | |||
| 2LR1 | Predicted | e2lr1A1 | |||
| 4BD2 | Predicted | e4bd2A2 | |||
| 4BD6 | Predicted | e4bd6A2 | |||
| 4BD7 | Predicted | e4bd7A1 e4bd7D2 e4bd7C2 e4bd7B1 | |||
| 4BD8 | Predicted | e4bd8C2 e4bd8A2 e4bd8B2 e4bd8D2 | |||
| 4BDU | Predicted | e4bduC4 e4bduB4 e4bduD4 e4bduA1 | |||
| 4S0O | Predicted | e4s0oA1 e4s0oB1 | |||
| 4S0P | Predicted | e4s0pA1 e4s0pB1 | |||
| 4ZIE | Predicted | e4zieA1 | |||
| 4ZIF | Predicted | e4zifA1 | |||
| 4ZIG | Predicted | e4zigA1 | |||
| 4ZIH | Predicted | e4zihA1 | |||
| 4ZII | Predicted | e4ziiA1 | |||
| 5W5X | Predicted | e5w5xA1 | |||
| 5W5Z | Predicted | e5w5zA1 | |||
| 5W60 | Predicted | e5w60A1 | |||
| 5W61 | Predicted | e5w61A1 | |||
| 6EB6 | Predicted | e6eb6A1 |