DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q08345
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q08345 | Download | Predicted | Q08345_nD2 Q08345_nD1 Q08345_nD4 | jelly-roll jelly-roll Protein kinase/SAICAR synthase/ATP-grasp | |
| 3ZOS | Predicted | e3zosB1 e3zosA2 | |||
| 4AG4 | Predicted | e4ag4A3 e4ag4A4 | |||
| 4BKJ | Predicted | e4bkjB1 e4bkjA2 | |||
| 4CKR | Predicted | e4ckrA1 | |||
| 5BVK | Predicted | e5bvkA1 | |||
| 5BVN | Predicted | e5bvnA1 | |||
| 5BVO | Predicted | e5bvoA1 | |||
| 5BVW | Predicted | e5bvwA1 | |||
| 5FDP | Predicted | e5fdpA1 | |||
| 5FDX | Predicted | e5fdxA1 e5fdxB1 | |||
| 6BRJ | Predicted | e6brjA1 | |||
| 6BSD | Predicted | e6bsdA1 | |||
| 6FEW | Predicted | e6fewA1 | |||
| 6FEX | Predicted | e6fexA1 | |||
| 6FIL | Predicted | e6filA1 | |||
| 6FIN | Predicted | e6finA1 | |||
| 6FIO | Predicted | e6fioA1 | |||
| 6FIQ | Predicted | e6fiqA1 | |||
| 6GWR | Predicted | e6gwrA1 e6gwrB1 | |||
| 6HP9 | Predicted | e6hp9A1 e6hp9B1 |