DB15035 Zanubrutinib
InChI Key: RNOAOAWBMHREKO-QFIPXVFZSA-N
SMILES: NC(=O)C1=C2NCC[C@@H](C3CCN(CC3)C(=O)C=C)N2N=C1C1=CC=C(OC2=CC=CC=C2)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q08881
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q08881 | Download | Predicted | Q08881_nD2 Q08881_nD5 | Btk/CHORD zinc fingers Protein kinase/SAICAR synthase/ATP-grasp | |
| 1SM2 | Predicted | e1sm2A1 e1sm2B1 | |||
| 1SNU | Predicted | e1snuB1 e1snuA1 | |||
| 1SNX | Predicted | e1snxA1 e1snxB1 | |||
| 2E6I | Predicted | e2e6iA1 | |||
| 2LMJ | Predicted | e2lmjA1 | |||
| 2YUQ | Predicted | e2yuqA1 | |||
| 3MIY | Predicted | e3miyA1 e3miyB1 | |||
| 3MJ1 | Predicted | e3mj1A2 | |||
| 3MJ2 | Predicted | e3mj2A1 | |||
| 3QGW | Predicted | e3qgwA1 e3qgwB1 | |||
| 3QGY | Predicted | e3qgyA1 e3qgyB1 | |||
| 3T9T | Predicted | e3t9tA1 | |||
| 3V5J | Predicted | e3v5jA1 e3v5jB1 | |||
| 3V5L | Predicted | e3v5lC1 e3v5lD1 e3v5lA1 e3v5lB2 | |||
| 3V8T | Predicted | e3v8tB1 e3v8tA2 | |||
| 3V8W | Predicted | e3v8wA1 e3v8wB1 | |||
| 4HCT | Predicted | e4hctA1 | |||
| 4HCU | Predicted | e4hcuA1 | |||
| 4HCV | Predicted | e4hcvA1 | |||
| 4KIO | Predicted | e4kioC1 e4kioA1 e4kioB1 e4kioD1 | |||
| 4L7S | Predicted | e4l7sA1 e4l7sB1 | |||
| 4M0Y | Predicted | e4m0yA1 | |||
| 4M0Z | Predicted | e4m0zA1 | |||
| 4M12 | Predicted | e4m12A1 | |||
| 4M13 | Predicted | e4m13A1 | |||
| 4M14 | Predicted | e4m14A1 | |||
| 4M15 | Predicted | e4m15A1 | |||
| 4MF0 | Predicted | e4mf0A2 e4mf0B2 | |||
| 4MF1 | Predicted | e4mf1A1 e4mf1B1 | |||
| 4PP9 | Predicted | e4pp9A1 e4pp9B1 | |||
| 4PPA | Predicted | e4ppaA1 e4ppaB1 | |||
| 4PPB | Predicted | e4ppbA1 e4ppbB1 | |||
| 4PPC | Predicted | e4ppcA1 e4ppcB1 | |||
| 4PQN | Predicted | e4pqnA1 | |||
| 4QD6 | Predicted | e4qd6A1 e4qd6B1 | |||
| 4RFM | Predicted | e4rfmA1 |