DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q12866
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q12866 | Download | Predicted | Q12866_nD2 Q12866_nD5 Q12866_nD1 | Immunoglobulin-like beta-sandwich Protein kinase/SAICAR synthase/ATP-grasp Immunoglobulin-like beta-sandwich | |
| 2DBJ | Predicted | e2dbjA1 | |||
| 2P0C | Predicted | e2p0cA1 e2p0cB1 | |||
| 3BPR | Predicted | e3bprB1 e3bprA1 e3bprC1 e3bprD1 | |||
| 3BRB | Predicted | e3brbA1 e3brbB1 | |||
| 3TCP | Predicted | e3tcpA1 e3tcpB1 | |||
| 4M3Q | Predicted | e4m3qB2 e4m3qA2 | |||
| 4MH7 | Predicted | e4mh7A1 e4mh7B1 | |||
| 4MHA | Predicted | e4mhaA1 e4mhaB1 | |||
| 5K0K | Predicted | e5k0kA1 e5k0kB1 | |||
| 5K0X | Predicted | e5k0xA1 e5k0xB1 | |||
| 5TC0 | Predicted | e5tc0B1 e5tc0A1 | |||
| 5TD2 | Predicted | e5td2A1 e5td2B1 | |||
| 5U6C | Predicted | e5u6cA1 e5u6cB1 | |||
| 6MEP | Predicted | e6mepA1 e6mepB1 |