DB00131 Adenosine phosphate
InChI Key: UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES: NC1=C2N=CN([C@@H]3O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1
Small molecule PDB accession : AMP
Drug action: activator
List of PDB structures and/or AlphaFold models with target protein Q13131
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q13131 | Download | Predicted | Q13131_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 4RED | Predicted | e4redB1 e4redA1 | |||
| 4RER | Predicted | e4rerA2 e4rerA1 | |||
| 4REW | Predicted | e4rewA2 e4rewA1 | |||
| 5EZV | Predicted | e5ezvA2 | |||
| 6C9F | Predicted | e6c9fA1 e6c9fA2 | |||
| 6C9G | Predicted | e6c9gA2 e6c9gA1 | |||
| 6C9H | Predicted | e6c9hA2 e6c9hA1 | |||
| 6C9J | Predicted | e6c9jA2 e6c9jA1 |