DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q13546
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q13546 | Download | Predicted | Q13546_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 4ITH | Predicted | e4ithB2 e4ithA1 | |||
| 4ITI | Predicted | e4itiB2 e4itiA2 | |||
| 4ITJ | Predicted | e4itjB1 e4itjA2 | |||
| 4NEU | Predicted | e4neuA2 e4neuB1 | |||
| 5HX6 | Predicted | e5hx6A1 e5hx6B1 | |||
| 5TX5 | Predicted | e5tx5A1 e5tx5B1 | |||
| 6AC5 | Predicted | e6ac5A1 | |||
| 6C3E | Predicted | e6c3eB1 e6c3eA1 | |||
| 6C4D | Predicted | e6c4dD1 e6c4dA1 e6c4dB1 e6c4dC1 | |||
| 6HHO | Predicted | e6hhoA1 e6hhoB1 | |||
| 6NW2 | Predicted | e6nw2A1 e6nw2B1 | |||
| 6NYH | Predicted | e6nyhA1 e6nyhB1 | |||
| 6OCQ | Predicted | e6ocqB1 e6ocqA1 | |||
| 6R5F | Predicted | e6r5fA1 e6r5fB1 e6r5fC1 e6r5fD1 | |||
| 6RLN | Predicted | e6rlnB1 e6rlnA1 |