DB06712 Nilvadipine
InChI Key: FAIIFDPAEUKBEP-UHFFFAOYSA-N
SMILES: COC(=O)C1=C(NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C)C#N
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q13936
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q13936 | Download | Predicted | Q13936_nD1 Q13936_nD2 | Voltage-gated ion channels EF-hand | |
| 2BE6 | Predicted | e2be6D1 e2be6F1 | |||
| 3G43 | Predicted | e3g43E1 | |||
| 3OXQ | Predicted | e3oxqF1 e3oxqE1 | |||
| 6C0A | Predicted | e6c0aB1 | |||
| 6DAD | Predicted | e6dadD1 e6dadC1 | |||
| 6DAE | Predicted | e6daeD1 e6daeC1 | |||
| 6DAF | Predicted | e6dafD1 |