DB01645 Genistein
InChI Key: TZBJGXHYKVUXJN-UHFFFAOYSA-N
SMILES: OC1=CC=C(C=C1)C1=COC2=C(C(O)=CC(O)=C2)C1=O
Small molecule PDB accession : GEN
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein Q14289
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q14289 | Download | Predicted | Q14289_nD1 Q14289_nD2 Q14289_nD5 Q14289_nD4 | beta-Grasp Acyl-CoA binding protein-like Four-helical up-and-down bundle Protein kinase/SAICAR synthase/ATP-grasp | |
2LK4 | Predicted | e2lk4A1 | |||
3CC6 | Predicted | e3cc6A1 | |||
3ET7 | Predicted | e3et7A1 | |||
3FZO | Predicted | e3fzoA1 | |||
3FZP | Predicted | e3fzpA1 | |||
3FZR | Predicted | e3fzrA1 | |||
3FZS | Predicted | e3fzsA1 | |||
3FZT | Predicted | e3fztA1 | |||
3GM1 | Predicted | e3gm1A1 e3gm1B1 | |||
3GM2 | Predicted | e3gm2A1 | |||
3GM3 | Predicted | e3gm3A1 | |||
3H3C | Predicted | e3h3cA1 | |||
3U3F | Predicted | e3u3fB1 e3u3fA1 e3u3fC1 e3u3fD1 | |||
4EKU | Predicted | e4ekuA4 e4ekuA1 e4ekuA3 | |||
4H1J | Predicted | e4h1jA1 | |||
4H1M | Predicted | e4h1mA2 | |||
4R32 | Predicted | e4r32A1 | |||
4XEF | Predicted | e4xefA1 e4xefD1 | |||
4XEK | Predicted | e4xekA1 | |||
4XEV | Predicted | e4xevA1 e4xevD1 | |||
5TO8 | Predicted | e5to8A1 | |||
5TOB | Predicted | e5tobA1 |