DB13146 Fluciclovine (18F)
InChI Key: NTEDWGYJNHZKQW-DGMDOPGDSA-N
SMILES: N[C@]1(C[C@H]([18F])C1)C(O)=O
Small molecule PDB accession : n/a
Drug action: binder
List of PDB structures and/or AlphaFold models with target protein Q15758
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q15758 | Download | Predicted | Q15758_nD1 | Proton glutamate symport protein | |
| 5LLM | Predicted | e5llmA1 | |||
| 5LLU | Predicted | e5lluA1 | |||
| 5LM4 | Predicted | e5lm4A1 | |||
| 6GCT | Predicted | e6gctA1 e6gctB1 e6gctC1 | |||
| 6MP6 | Predicted | e6mp6A1 e6mp6B1 e6mp6C1 | |||
| 6MPB | Predicted | e6mpbB1 e6mpbC1 e6mpbA1 | |||
| 6RVX | Predicted | e6rvxA1 e6rvxB1 e6rvxC1 | |||
| 6RVY | Predicted | e6rvyA1 e6rvyB1 e6rvyC1 |