DB12741 DTP-348
InChI Key: AVSMSXHPIYIKIJ-UHFFFAOYSA-N
SMILES: CC1=NC=C(N1CCNS(N)(=O)=O)N(=O)=O
Small molecule PDB accession : 2VQ
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q16790
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q16790 | Download | Predicted | Q16790_nD1 | Carbonic anhydrase | |
| 3IAI | Predicted | e3iaiA1 e3iaiB1 e3iaiC1 e3iaiD1 | |||
| 5DVX | Predicted | e5dvxB1 e5dvxA1 | |||
| 5FL4 | Predicted | e5fl4A1 e5fl4B1 e5fl4C1 e5fl4D1 | |||
| 5FL5 | Predicted | e5fl5A1 e5fl5B1 e5fl5C1 e5fl5D1 | |||
| 5FL6 | Predicted | e5fl6A1 e5fl6B1 e5fl6C1 e5fl6D1 | |||
| 6FE0 | Predicted | e6fe0A1 e6fe0B1 e6fe0C1 e6fe0D1 | |||
| 6FE1 | Predicted | e6fe1A1 e6fe1B1 e6fe1C1 e6fe1D1 | |||
| 6FE2 | Predicted | e6fe2A1 e6fe2B1 e6fe2C1 e6fe2D1 | |||
| 6G98 | Predicted | e6g98B1 e6g98A1 e6g98C1 e6g98D1 | |||
| 6G9U | Predicted | e6g9uA1 e6g9uB1 e6g9uC1 e6g9uD1 | |||
| 6RQN | Predicted | e6rqnA1 | |||
| 6RQQ | Predicted | e6rqqA1 e6rqqC1 | |||
| 6RQU | Predicted | e6rquA1 | |||
| 6RQW | Predicted | e6rqwA1 |