DB00126 Ascorbic acid
InChI Key: CIWBSHSKHKDKBQ-JLAZNSOCSA-N
SMILES: [H][C@@]1(OC(=O)C(O)=C1O)[C@@H](O)CO
Small molecule PDB accession : ASC
Drug action: activator
List of PDB structures and/or AlphaFold models with target protein Q6NS38
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q6NS38 | Download | Predicted | Q6NS38_nD1 | jelly-roll | |
3BTX | Predicted | e3btxA1 | |||
3BTY | Predicted | e3btyA1 | |||
3BTZ | Predicted | e3btzA1 | |||
3BU0 | Predicted | e3bu0A1 | |||
3BUC | Predicted | e3bucA1 | |||
3H8O | Predicted | e3h8oA1 | |||
3H8R | Predicted | e3h8rA1 | |||
3H8X | Predicted | e3h8xA1 | |||
3RZG | Predicted | e3rzgA1 | |||
3RZH | Predicted | e3rzhA1 | |||
3RZJ | Predicted | e3rzjA1 | |||
3RZK | Predicted | e3rzkA1 | |||
3RZL | Predicted | e3rzlD1 e3rzlA1 | |||
3RZM | Predicted | e3rzmA1 | |||
3S57 | Predicted | e3s57A1 | |||
3S5A | Predicted | e3s5aA1 | |||
4MG2 | Predicted | e4mg2A1 | |||
4MGT | Predicted | e4mgtA1 |