DB06836 N-(5-{4-Chloro-3-[(2-hydroxyethyl)sulfamoyl]phenyl}-4-methyl-1,3-thiazol-2-yl)acetamide
InChI Key: JFVNFXCESCXMBC-UHFFFAOYSA-N
SMILES: [H]N(CCO)S(=O)(=O)C1=C(Cl)C=CC(=C1)C1=C(C)N=C(S1)N([H])C(C)=O
Small molecule PDB accession : 093
Drug action: n/a
List of drug binding-associated PTMs
List of PDB structures and/or AlphaFold models with target protein Q8NEB9
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q8NEB9 | Download | Predicted | Q8NEB9_nD3 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 3IHY | Predicted | e3ihyA2 e3ihyB2 e3ihyC2 e3ihyD2 e3ihyE2 e3ihyA1 e3ihyB1 e3ihyC1 e3ihyD1 e3ihyE1 | |||
| 3LS8 | Predicted | e3ls8A1 e3ls8B2 e3ls8B1 e3ls8A2 | |||
| 4OYS | Predicted | e4oysA2 e4oysA1 | |||
| 4PH4 | Predicted | e4ph4B1 e4ph4B2 | |||
| 4UWF | Predicted | e4uwfA2 e4uwfA1 | |||
| 4UWG | Predicted | e4uwgA1 e4uwgA2 | |||
| 4UWH | Predicted | e4uwhA2 e4uwhA1 | |||
| 4UWK | Predicted | e4uwkA2 e4uwkA1 | |||
| 4UWL | Predicted | e4uwlA1 e4uwlA2 | |||
| 5ANL | Predicted | e5anlA2 e5anlA1 | |||
| 5ENN | Predicted | e5ennA2 e5ennB2 e5ennA1 e5ennB1 | |||
| 6HOG | Predicted | e6hogA1 | |||
| 6I3U | Predicted | e6i3uA1 e6i3uA2 |