DB12255 Vadadustat
InChI Key: JGRXMPYUTJLTKT-UHFFFAOYSA-N
SMILES: OC(=O)CNC(=O)C1=C(O)C=C(C=N1)C1=CC(Cl)=CC=C1
Small molecule PDB accession : A1Z
Drug action: stabilization
List of PDB structures and/or AlphaFold models with target protein Q99814
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q99814 | Download | Predicted | Q99814_nD2 Q99814_nD3 Q99814_nD1 | Profilin-like Profilin-like HLH-like | |
| 1P97 | Predicted | e1p97A1 | |||
| 2A24 | Predicted | e2a24A1 | |||
| 3F1N | Predicted | e3f1nA1 | |||
| 3F1O | Predicted | e3f1oA1 | |||
| 3F1P | Predicted | e3f1pA1 | |||
| 3H7W | Predicted | e3h7wA1 | |||
| 3H82 | Predicted | e3h82A1 | |||
| 4GHI | Predicted | e4ghiA1 | |||
| 4GS9 | Predicted | e4gs9A1 | |||
| 4PKY | Predicted | e4pkyG1 | |||
| 4XT2 | Predicted | e4xt2C1 e4xt2A1 | |||
| 5KIZ | Predicted | e5kizA1 | |||
| 5TBM | Predicted | e5tbmA1 | |||
| 5UFP | Predicted | e5ufpA1 | |||
| 6CZW | Predicted | e6czwA1 | |||
| 6D09 | Predicted | e6d09A1 | |||
| 6D0B | Predicted | e6d0bA1 | |||
| 6D0C | Predicted | e6d0cA1 |