DB15463 Belzutifan
InChI Key: LOMMPXLFBTZENJ-ZACQAIPSSA-N
SMILES: CS(=O)(=O)C1=CC=C(OC2=CC(=CC(F)=C2)C#N)C2=C1[C@H](O)[C@H](F)[C@@H]2F
Small molecule PDB accession : 72Q
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q99814
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q99814 | Download | Predicted | Q99814_nD2 Q99814_nD3 Q99814_nD1 | Profilin-like Profilin-like HLH-like | |
| 1P97 | Predicted | e1p97A1 | |||
| 2A24 | Predicted | e2a24A1 | |||
| 3F1N | Predicted | e3f1nA1 | |||
| 3F1O | Predicted | e3f1oA1 | |||
| 3F1P | Predicted | e3f1pA1 | |||
| 3H7W | Predicted | e3h7wA1 | |||
| 3H82 | Predicted | e3h82A1 | |||
| 4GHI | Predicted | e4ghiA1 | |||
| 4GS9 | Predicted | e4gs9A1 | |||
| 4PKY | Predicted | e4pkyG1 | |||
| 4XT2 | Predicted | e4xt2C1 e4xt2A1 | |||
| 5KIZ | Predicted | e5kizA1 | |||
| 5TBM | Predicted | e5tbmA1 | |||
| 5UFP | Predicted | e5ufpA1 | |||
| 6CZW | Predicted | e6czwA1 | |||
| 6D09 | Predicted | e6d09A1 | |||
| 6D0B | Predicted | e6d0bA1 | |||
| 6D0C | Predicted | e6d0cA1 |