DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein Q9C0B1
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q9C0B1 | Download | Predicted | Q9C0B1_nD1 | jelly-roll | |
| 3LFM | Predicted | e3lfmA4 e3lfmA2 | |||
| 4CXW | Predicted | e4cxwA2 e4cxwA1 | |||
| 4CXX | Predicted | e4cxxA1 e4cxxA2 | |||
| 4CXY | Predicted | e4cxyA2 e4cxyA1 | |||
| 4IDZ | Predicted | e4idzA3 e4idzA4 | |||
| 4IE0 | Predicted | e4ie0A3 e4ie0A4 | |||
| 4IE4 | Predicted | e4ie4A3 e4ie4A4 | |||
| 4IE5 | Predicted | e4ie5A3 e4ie5A2 | |||
| 4IE6 | Predicted | e4ie6A1 e4ie6A2 | |||
| 4IE7 | Predicted | e4ie7A3 e4ie7A4 | |||
| 4QHO | Predicted | e4qhoA1 e4qhoA2 | |||
| 4QKN | Predicted | e4qknA2 e4qknA1 | |||
| 4ZS2 | Predicted | e4zs2A1 e4zs2A2 | |||
| 4ZS3 | Predicted | e4zs3A2 e4zs3A1 | |||
| 5DAB | Predicted | e5dabA2 e5dabA3 | |||
| 5F8P | Predicted | e5f8pA1 e5f8pA2 | |||
| 5ZMD | Predicted | e5zmdG1 e5zmdA1 e5zmdC1 e5zmdE2 e5zmdA2 e5zmdC2 e5zmdE3 e5zmdG2 | |||
| 6AEJ | Predicted | e6aejA1 e6aejA2 | |||
| 6AK4 | Predicted | e6ak4A2 e6ak4A3 | |||
| 6AKW | Predicted | e6akwA1 e6akwA2 |