DB00126 Ascorbic acid
InChI Key: CIWBSHSKHKDKBQ-JLAZNSOCSA-N
SMILES: [H][C@@]1(OC(=O)C(O)=C1O)[C@@H](O)CO
Small molecule PDB accession : ASC
Drug action: cofactor
List of PDB structures and/or AlphaFold models with target protein Q9GZT9
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q9GZT9 | Download | Predicted | Q9GZT9_nD2 | jelly-roll | |
| 2G19 | Predicted | e2g19A1 | |||
| 2G1M | Predicted | e2g1mA1 | |||
| 2HBT | Predicted | e2hbtA2 | |||
| 2HBU | Predicted | e2hbuA1 | |||
| 2Y33 | Predicted | e2y33A1 | |||
| 2Y34 | Predicted | e2y34A1 | |||
| 3HQR | Predicted | e3hqrA1 | |||
| 3HQU | Predicted | e3hquA1 | |||
| 3OUH | Predicted | e3ouhA1 | |||
| 3OUI | Predicted | e3ouiA3 | |||
| 3OUJ | Predicted | e3oujA1 | |||
| 4BQW | Predicted | e4bqwA1 | |||
| 4BQX | Predicted | e4bqxA1 | |||
| 4BQY | Predicted | e4bqyA1 | |||
| 4JZR | Predicted | e4jzrA1 | |||
| 4KBZ | Predicted | e4kbzA1 | |||
| 4UWD | Predicted | e4uwdA1 | |||
| 5A3U | Predicted | e5a3uC1 e5a3uA1 e5a3uB1 | |||
| 5L9B | Predicted | e5l9bA1 e5l9bB1 | |||
| 5L9R | Predicted | e5l9rA1 | |||
| 5L9V | Predicted | e5l9vA1 e5l9vB1 | |||
| 5LA9 | Predicted | e5la9B1 e5la9A1 | |||
| 5LAS | Predicted | e5lasA1 e5lasB1 | |||
| 5LAT | Predicted | e5latA1 | |||
| 5LB6 | Predicted | e5lb6A1 | |||
| 5LBB | Predicted | e5lbbA1 | |||
| 5LBC | Predicted | e5lbcA1 | |||
| 5LBE | Predicted | e5lbeA1 | |||
| 5LBF | Predicted | e5lbfA1 | |||
| 5OX5 | Predicted | e5ox5A1 | |||
| 5OX6 | Predicted | e5ox6A1 | |||
| 5V18 | Predicted | e5v18A1 | |||
| 6NMQ | Predicted | e6nmqA1 | |||
| 6ST3 | Predicted | e6st3A1 e6st3B1 |