DB14491 Ferrous fumarate
InChI Key: PMVSDNDAUGGCCE-TYYBGVCCSA-L
SMILES: [Fe++].[H]\C(=C(\[H])C([O-])=O)C([O-])=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein Q9GZT9
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q9GZT9 | Download | Predicted | Q9GZT9_nD2 | jelly-roll | |
2G19 | Predicted | e2g19A1 | |||
2G1M | Predicted | e2g1mA1 | |||
2HBT | Predicted | e2hbtA2 | |||
2HBU | Predicted | e2hbuA1 | |||
2Y33 | Predicted | e2y33A1 | |||
2Y34 | Predicted | e2y34A1 | |||
3HQR | Predicted | e3hqrA1 | |||
3HQU | Predicted | e3hquA1 | |||
3OUH | Predicted | e3ouhA1 | |||
3OUI | Predicted | e3ouiA3 | |||
3OUJ | Predicted | e3oujA1 | |||
4BQW | Predicted | e4bqwA1 | |||
4BQX | Predicted | e4bqxA1 | |||
4BQY | Predicted | e4bqyA1 | |||
4JZR | Predicted | e4jzrA1 | |||
4KBZ | Predicted | e4kbzA1 | |||
4UWD | Predicted | e4uwdA1 | |||
5A3U | Predicted | e5a3uC1 e5a3uA1 e5a3uB1 | |||
5L9B | Predicted | e5l9bA1 e5l9bB1 | |||
5L9R | Predicted | e5l9rA1 | |||
5L9V | Predicted | e5l9vA1 e5l9vB1 | |||
5LA9 | Predicted | e5la9B1 e5la9A1 | |||
5LAS | Predicted | e5lasA1 e5lasB1 | |||
5LAT | Predicted | e5latA1 | |||
5LB6 | Predicted | e5lb6A1 | |||
5LBB | Predicted | e5lbbA1 | |||
5LBC | Predicted | e5lbcA1 | |||
5LBE | Predicted | e5lbeA1 | |||
5LBF | Predicted | e5lbfA1 | |||
5OX5 | Predicted | e5ox5A1 | |||
5OX6 | Predicted | e5ox6A1 | |||
5V18 | Predicted | e5v18A1 | |||
6NMQ | Predicted | e6nmqA1 | |||
6ST3 | Predicted | e6st3A1 e6st3B1 |