DB13346 Bufexamac
InChI Key: MXJWRABVEGLYDG-UHFFFAOYSA-N
SMILES: CCCCOC1=CC=C(CC(=O)NO)C=C1
Small molecule PDB accession : A4Z
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q9UBN7
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
Q9UBN7 | Download | Predicted | Q9UBN7_nD3 Q9UBN7_nD2 Q9UBN7_nD1 | RING/U-box-like HAD domain-related HAD domain-related | |
3C5K | Predicted | e3c5kA1 | |||
3GV4 | Predicted | e3gv4A2 | |||
3PHD | Predicted | e3phdC2 e3phdD2 e3phdA1 e3phdB1 | |||
5B8D | Predicted | e5b8dA1 | |||
5EDU | Predicted | e5eduB2 e5eduA2 | |||
5KH3 | Predicted | e5kh3A1 | |||
5KH7 | Predicted | e5kh7A1 | |||
5KH9 | Predicted | e5kh9A1 | |||
5WBN | Predicted | e5wbnA1 | |||
5WPB | Predicted | e5wpbA1 | |||
6CE6 | Predicted | e6ce6A1 | |||
6CE8 | Predicted | e6ce8A1 | |||
6CEA | Predicted | e6ceaA1 | |||
6CEC | Predicted | e6cecA1 | |||
6CED | Predicted | e6cedA1 | |||
6CEE | Predicted | e6ceeA1 | |||
6CEF | Predicted | e6cefA1 |