DB13729 Camostat
InChI Key: XASIMHXSUQUHLV-UHFFFAOYSA-N
SMILES: CN(C)C(=O)COC(=O)CC1=CC=C(OC(=O)C2=CC=C(NC(N)=N)C=C2)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q9Y5Y6
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q9Y5Y6 | Download | Predicted | Q9Y5Y6_nD8 Q9Y5Y6_nD4 Q9Y5Y6_nD7 Q9Y5Y6_nD6 Q9Y5Y6_nD5 | cradle loop barrel EGF-like EGF-like EGF-like EGF-like | |
| 1EAW | Predicted | e1eawC1 e1eawA1 | |||
| 1EAX | Predicted | e1eaxA1 | |||
| 2GV6 | Predicted | e2gv6A1 | |||
| 2GV7 | Predicted | e2gv7A1 | |||
| 3BN9 | Predicted | e3bn9B1 e3bn9A1 | |||
| 3NCL | Predicted | e3nclA1 | |||
| 3NPS | Predicted | e3npsA1 | |||
| 3P8F | Predicted | e3p8fA1 | |||
| 3P8G | Predicted | e3p8gA1 | |||
| 3SO3 | Predicted | e3so3A1 | |||
| 4IS5 | Predicted | e4is5A1 | |||
| 4ISL | Predicted | e4islA2 | |||
| 4ISN | Predicted | e4isnA2 | |||
| 4ISO | Predicted | e4isoA2 | |||
| 4JYT | Predicted | e4jytA1 | |||
| 4JZ1 | Predicted | e4jz1A1 | |||
| 4JZI | Predicted | e4jziA1 | |||
| 4O97 | Predicted | e4o97A1 | |||
| 4O9V | Predicted | e4o9vA1 | |||
| 4R0I | Predicted | e4r0iA1 | |||
| 5LYO | Predicted | e5lyoA1 e5lyoB1 e5lyoC1 | |||
| 6N4T | Predicted | e6n4tA1 |