DB09074 Olaparib
InChI Key: FDLYAMZZIXQODN-UHFFFAOYSA-N
SMILES: FC1=CC=C(CC2=NNC(=O)C3=CC=CC=C23)C=C1C(=O)N1CCN(CC1)C(=O)C1CC1
Small molecule PDB accession : 09L
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q9Y6F1
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q9Y6F1 | Download | Predicted | Q9Y6F1_nD2 Q9Y6F1_nD3 | Domain of poly(ADP-ribose) polymerase ADP-ribosylation | |
| 2EOC | Predicted | e2eocA1 | |||
| 3C49 | Predicted | e3c49A1 e3c49A2 | |||
| 3C4H | Predicted | e3c4hA1 e3c4hA2 | |||
| 3CE0 | Predicted | e3ce0A1 e3ce0A2 | |||
| 3FHB | Predicted | e3fhbA1 e3fhbA2 | |||
| 4GV0 | Predicted | e4gv0A1 e4gv0A2 | |||
| 4GV2 | Predicted | e4gv2A1 e4gv2A2 | |||
| 4GV4 | Predicted | e4gv4A1 e4gv4A2 | |||
| 4L6Z | Predicted | e4l6zA1 e4l6zA2 | |||
| 4L70 | Predicted | e4l70A2 e4l70A1 | |||
| 4L7L | Predicted | e4l7lA2 e4l7lA1 | |||
| 4L7N | Predicted | e4l7nA2 e4l7nA1 | |||
| 4L7O | Predicted | e4l7oA2 e4l7oA1 | |||
| 4L7P | Predicted | e4l7pA2 e4l7pA1 | |||
| 4L7R | Predicted | e4l7rA2 e4l7rA1 | |||
| 4L7U | Predicted | e4l7uA2 e4l7uA1 |