DB01262 Decitabine
InChI Key: XAUDJQYHKZQPEU-KVQBGUIXSA-N
SMILES: NC1=NC(=O)N(C=N1)[C@H]1C[C@H](O)[C@@H](CO)O1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein Q9Y6K1
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| Q9Y6K1 | Download | Predicted | Q9Y6K1_nD2 Q9Y6K1_nD3 Q9Y6K1_nD5 Q9Y6K1_nD4 | SH3 RING/U-box-like Rossmann-like RING/U-box-like | |
| 2QRV | Predicted | e2qrvA1 e2qrvD1 e2qrvE1 e2qrvH1 | |||
| 3A1A | Predicted | e3a1aA2 e3a1aA1 | |||
| 3A1B | Predicted | e3a1bA2 | |||
| 3LLR | Predicted | e3llrB1 e3llrA1 e3llrC1 e3llrD1 e3llrE1 | |||
| 4QBQ | Predicted | e4qbqA1 e4qbqC1 e4qbqA2 e4qbqC2 | |||
| 4QBR | Predicted | e4qbrA2 e4qbrC2 e4qbrA1 e4qbrC1 | |||
| 4QBS | Predicted | e4qbsA2 e4qbsA1 | |||
| 4U7P | Predicted | e4u7pA1 e4u7pA3 e4u7pA2 | |||
| 4U7T | Predicted | e4u7tA1 e4u7tC1 e4u7tA3 e4u7tC3 e4u7tA2 e4u7tC2 | |||
| 5YX2 | Predicted | e5yx2A1 e5yx2D1 | |||
| 6BRR | Predicted | e6brrA1 e6brrD1 | |||
| 6F57 | Predicted | e6f57D1 e6f57A1 |