DB00091 Cyclosporine
InChI Key: PMATZTZNYRCHOR-CGLBZJNRSA-N
SMILES: CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C
Small molecule PDB accession : n/a
List of proteins that are targets for DB00091
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P49069_DB00091 | P49069 | binder | Calcium signal-modulating cyclophilin ligand | |
| 2 | P30405_DB00091 | P30405 | binder | Peptidyl-prolyl cis-trans isomerase F, mitochondrial | |
| 3 | P62937_DB00091 | P62937 | inhibitor | Peptidyl-prolyl cis-trans isomerase A | |
| 4 | Q96LZ3_DB00091 | Q96LZ3 | inhibitor | Calcineurin subunit B type 2 |