DB00115 Cyanocobalamin
InChI Key: RMRCNWBMXRMIRW-WZHZPDAFSA-L
SMILES: C[C@H](CNC(=O)CC[C@]1(C)[C@@H](CC(N)=O)[C@H]2N=C1\C(C)=C1/N=C(/C=C3\N=C(\C(\C)=C4\[C@@H](CCC(N)=O)[C@](C)(CC(N)=O)[C@@]2(C)N4[Co+]C#N)[C@@](C)(CC(N)=O)[C@@H]3CCC(N)=O)C(C)(C)[C@@H]1CCC(N)=O)OP([O-])(=O)O[C@@H]1[C@@H](CO)O[C@@H]([C@@H]1O)N1C=NC2=C1C=C(C)C(C)=C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB00115
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P42898_DB00115 | P42898 | cofactor | Methylenetetrahydrofolate reductase | |
| 2 | Q9Y4U1_DB00115 | Q9Y4U1 | cofactor | Cyanocobalamin reductase / alkylcobalamin dealkylase | |
| 3 | P22033_DB00115 | P22033 | cofactor | Methylmalonyl-CoA mutase, mitochondrial | |
| 4 | Q8IVH4_DB00115 | Q8IVH4 | binder | Methylmalonic aciduria type A protein, mitochondrial | |
| 5 | Q9UBK8_DB00115 | Q9UBK8 | cofactor | Methionine synthase reductase | |
| 6 | Q99707_DB00115 | Q99707 | cofactor | Methionine synthase |