DB00132 alpha-Linolenic acid
InChI Key: DTOSIQBPPRVQHS-PDBXOOCHSA-N
SMILES: CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O
Small molecule PDB accession : LNL
List of proteins that are targets for DB00132
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q8NER1_DB00132 | Q8NER1 | inhibitor | Transient receptor potential cation channel subfamily V member 1 | |
2 | Q96RI1_DB00132 | Q96RI1 | agonist | Bile acid receptor | |
3 | Q07869_DB00132 | Q07869 | n/a | Peroxisome proliferator-activated receptor alpha | IC50(nM) = 1200.0 Kd(nM) = 7.9 |
4 | Q03181_DB00132 | Q03181 | n/a | Peroxisome proliferator-activated receptor delta | IC50(nM) = 16000.0 |
5 | P37231_DB00132 | P37231 | n/a | Peroxisome proliferator-activated receptor gamma | IC50(nM) = 6000.0 Kd(nM) = 2000.0 |
6 | P19793_DB00132 | P19793 | n/a | Retinoic acid receptor RXR-alpha | |
7 | O95864_DB00132 | O95864 | ligand | Acyl-CoA 6-desaturase | |
8 | O60427_DB00132 | O60427 | ligand | Acyl-CoA | |
9 | Q9NYP7_DB00132 | Q9NYP7 | substrate | Elongation of very long chain fatty acids protein 5 | |
10 | P32418_DB00132 | P32418 | n/a | Sodium/calcium exchanger 1 | |
11 | Q9NXB9_DB00132 | Q9NXB9 | substrate | Elongation of very long chain fatty acids protein 2 |