DB00170 Menadione
InChI Key: MJVAVZPDRWSRRC-UHFFFAOYSA-N
SMILES: CC1=CC(=O)C2=CC=CC=C2C1=O
Small molecule PDB accession : VK3
List of proteins that are targets for DB00170
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q9BQB6_DB00170 | Q9BQB6 | cofactor | Vitamin K epoxide reductase complex subunit 1 | |
2 | P07225_DB00170 | P07225 | activator | Vitamin K-dependent protein S | |
3 | P16083_DB00170 | P16083 | n/a | Ribosyldihydronicotinamide dehydrogenase [quinone] | |
4 | P15559_DB00170 | P15559 | n/a | NAD | |
5 | P00740_DB00170 | P00740 | activator | Coagulation factor IX | |
6 | P04070_DB00170 | P04070 | activator | Vitamin K-dependent protein C | |
7 | P00734_DB00170 | P00734 | activator | Prothrombin | |
8 | P02818_DB00170 | P02818 | agonist | Osteocalcin | |
9 | P38435_DB00170 | P38435 | cofactor | Vitamin K-dependent gamma-carboxylase | |
10 | Q8N0U8_DB00170 | Q8N0U8 | cofactor | Vitamin K epoxide reductase complex subunit 1-like protein 1 |