DB00179 Masoprocol
InChI Key: HCZKYJDFEPMADG-TXEJJXNPSA-N
SMILES: C[C@@H](CC1=CC(O)=C(O)C=C1)[C@H](C)CC1=CC(O)=C(O)C=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00179
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P09917_DB00179 | P09917 | inhibitor | Polyunsaturated fatty acid 5-lipoxygenase | IC50(nM) = 25.0 EC50(nM) = 330000.0 |
| 2 | P04278_DB00179 | P04278 | n/a | Sex hormone-binding globulin | |
| 3 | Q96QT4_DB00179 | Q96QT4 | inhibitor | Transient receptor potential cation channel subfamily M member 7 |