DB00206 Reserpine
InChI Key: QEVHRUUCFGRFIF-MDEJGZGSSA-N
SMILES: [H][C@]12C[C@@H](OC(=O)C3=CC(OC)=C(OC)C(OC)=C3)[C@H](OC)[C@@H](C(=O)OC)[C@@]1([H])C[C@@]1([H])N(CCC3=C1NC1=C3C=CC(OC)=C1)C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB00206
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | O15392_DB00206 | O15392 | n/a | Baculoviral IAP repeat-containing protein 5 | |
2 | Q05940_DB00206 | Q05940 | inhibitor | Synaptic vesicular amine transporter | Ki(nM) = 5.3 IC50(nM) = 13.0 Kd(nM) = 8.0 |
3 | P54219_DB00206 | P54219 | inhibitor | Chromaffin granule amine transporter |