DB00232 Methyclothiazide
InChI Key: CESYKOGBSMNBPD-UHFFFAOYSA-N
SMILES: CN1C(CCl)NC2=CC(Cl)=C(C=C2S1(=O)=O)S(N)(=O)=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB00232
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P22748_DB00232 | P22748 | inhibitor | Carbonic anhydrase 4 | |
2 | P00915_DB00232 | P00915 | inhibitor | Carbonic anhydrase 1 | |
3 | P00918_DB00232 | P00918 | inhibitor | Carbonic anhydrase 2 | |
4 | Q13621_DB00232 | Q13621 | inhibitor | Solute carrier family 12 member 1 |