DB00247 Methysergide
InChI Key: KPJZHOPZRAFDTN-NQUBZZJWSA-N
SMILES: [H][C@@]12CC3=CN(C)C4=C3C(=CC=C4)C1=C[C@H](CN2C)C(=O)NC(CC)CO
Small molecule PDB accession : n/a
List of proteins that are targets for DB00247
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P34969_DB00247 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | |
| 2 | P30939_DB00247 | P30939 | binder | 5-hydroxytryptamine receptor 1F | |
| 3 | P28566_DB00247 | P28566 | binder | 5-hydroxytryptamine receptor 1E | |
| 4 | P08908_DB00247 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | |
| 5 | P28335_DB00247 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | |
| 6 | P28223_DB00247 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | |
| 7 | P41595_DB00247 | P41595 | antagonist | 5-hydroxytryptamine receptor 2B | |
| 8 | P28222_DB00247 | P28222 | binder | 5-hydroxytryptamine receptor 1B |