DB00270 Isradipine
InChI Key: HMJIYCCIJYRONP-UHFFFAOYSA-N
SMILES: COC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC2=NON=C12)C(=O)OC(C)C
Small molecule PDB accession : n/a
List of proteins that are targets for DB00270
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P54289_DB00270 | P54289 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-1 | |
| 2 | Q01668_DB00270 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 3 | Q13698_DB00270 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 4 | Q13936_DB00270 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | IC50(nM) = 2.2 |
| 5 | O95180_DB00270 | O95180 | inhibitor | Voltage-dependent T-type calcium channel subunit alpha-1H | |
| 6 | Q9NY47_DB00270 | Q9NY47 | inhibitor | Voltage-dependent calcium channel subunit alpha-2/delta-2 | |
| 7 | Q08289_DB00270 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 |