DB00273 Topiramate
InChI Key: KJADKKWYZYXHBB-XBWDGYHZSA-N
SMILES: [H][C@@]12CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@]3([H])[C@]1([H])OC(C)(C)O2
Small molecule PDB accession : TOR
List of proteins that are targets for DB00273
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P14867_DB00273 | P14867 | agonist | Gamma-aminobutyric acid receptor subunit alpha-1 | |
2 | Q15878_DB00273 | Q15878 | antagonist | Voltage-dependent R-type calcium channel subunit alpha-1E | |
3 | P22748_DB00273 | P22748 | inhibitor | Carbonic anhydrase 4 | Ki(nM) = 4900.0 |
4 | P07451_DB00273 | P07451 | inhibitor | Carbonic anhydrase 3 | Ki(nM) = 780000.0 |
5 | P00915_DB00273 | P00915 | inhibitor | Carbonic anhydrase 1 | Ki(nM) = 56.0 IC50(nM) = 250.0 |
6 | P00918_DB00273 | P00918 | inhibitor | Carbonic anhydrase 2 | Ki(nM) = 5.0 IC50(nM) = 5.0 Kd(nM) = 13.8 |