DB00277 Theophylline
InChI Key: ZFXYFBGIUFBOJW-UHFFFAOYSA-N
SMILES: CN1C2=C(NC=N2)C(=O)N(C)C1=O
Small molecule PDB accession : TEP
List of proteins that are targets for DB00277
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P29275_DB00277 | P29275 | antagonist | Adenosine receptor A2b | Ki(nM) = 2700.0 |
2 | Q14432_DB00277 | Q14432 | inhibitor | cGMP-inhibited 3',5'-cyclic phosphodiesterase A | IC50(nM) = 360000.0 |
3 | P30542_DB00277 | P30542 | antagonist | Adenosine receptor A1 | Ki(nM) = 0.6 Kd(nM) = 12000.0 |
4 | Q92769_DB00277 | Q92769 | activator | Histone deacetylase 2 | |
5 | P29274_DB00277 | P29274 | antagonist | Adenosine receptor A2a | Ki(nM) = 0.6 Kd(nM) = 3630.0 EC50(nM) = 28200.0 |
6 | P27815_DB00277 | P27815 | inhibitor | cAMP-specific 3',5'-cyclic phosphodiesterase 4A | IC50(nM) = 386000.0 |
7 | P09874_DB00277 | P09874 | n/a | Poly [ADP-ribose] polymerase 1 | |
8 | O76074_DB00277 | O76074 | inhibitor | cGMP-specific 3',5'-cyclic phosphodiesterase | |
9 | Q07343_DB00277 | Q07343 | inhibitor | cAMP-specific 3',5'-cyclic phosphodiesterase 4B | Ki(nM) = 56800.0 IC50(nM) = 1780000.0 |
10 | Q15155_DB00277 | Q15155 | n/a | Nodal modulator 1 | |
11 | Q7Z5B4_DB00277 | Q7Z5B4 | n/a | Protein RIC-3 | |
12 | Q8TCT9_DB00277 | Q8TCT9 | n/a | Minor histocompatibility antigen H13 | |
13 | Q99829_DB00277 | Q99829 | n/a | Copine-1 | |
14 | Q9Y4R7_DB00277 | Q9Y4R7 | n/a | Tubulin monoglycylase TTLL3 |