DB00279 Liothyronine

InChI Key: AUYYCJSJGJYCDS-LBPRGKRZSA-N
SMILES: N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
Small molecule PDB accession : T3

List of proteins that are targets for DB00279
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P10827_DB00279 P10827 agonist Thyroid hormone receptor alpha Ki(nM) = 0.22
IC50(nM) = 0.24
Kd(nM) = 0.058
EC50(nM) = 0.41
2 P10828_DB00279 P10828 agonist Thyroid hormone receptor beta Ki(nM) = 0.08
IC50(nM) = 0.257
Kd(nM) = 0.081
EC50(nM) = 1.1
3 P12004_DB00279 P12004 antagonist Proliferating cell nuclear antigen IC50(nM) = 3600.0