DB00279 Liothyronine
InChI Key: AUYYCJSJGJYCDS-LBPRGKRZSA-N
SMILES: N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
Small molecule PDB accession : T3
List of proteins that are targets for DB00279
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P10827_DB00279 | P10827 | agonist | Thyroid hormone receptor alpha | Ki(nM) = 0.22 IC50(nM) = 0.24 Kd(nM) = 0.058 EC50(nM) = 0.41 |
2 | P10828_DB00279 | P10828 | agonist | Thyroid hormone receptor beta | Ki(nM) = 0.08 IC50(nM) = 0.257 Kd(nM) = 0.081 EC50(nM) = 1.1 |
3 | P12004_DB00279 | P12004 | antagonist | Proliferating cell nuclear antigen | IC50(nM) = 3600.0 |