DrugDomain - DB00285

DB00285 Venlafaxine

InChI Key: PNVNVHUZROJLTJ-UHFFFAOYSA-N
SMILES: COC1=CC=C(C=C1)C(CN(C)C)C1(O)CCCCC1
Small molecule PDB accession : n/a

List of proteins that are targets for DB00285

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P31645_DB00285 P31645 inhibitor Sodium-dependent serotonin transporter Ki(nM) = 7.5
IC50(nM) = 20.0
Kd(nM) = 8.9

2 P23975_DB00285 P23975 inhibitor Sodium-dependent noradrenaline transporter Ki(nM) = 210.0
IC50(nM) = 149.0
Kd(nM) = 1060.0

3 Q01959_DB00285 Q01959 inhibitor Sodium-dependent dopamine transporter Ki(nM) = 3070.0
IC50(nM) = 2550.0
Kd(nM) = 9300.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P31645_DB00285	P31645	inhibitor	Sodium-dependent serotonin transporter	Ki(nM) = 7.5 IC50(nM) = 20.0 Kd(nM) = 8.9
2	P23975_DB00285	P23975	inhibitor	Sodium-dependent noradrenaline transporter	Ki(nM) = 210.0 IC50(nM) = 149.0 Kd(nM) = 1060.0
3	Q01959_DB00285	Q01959	inhibitor	Sodium-dependent dopamine transporter	Ki(nM) = 3070.0 IC50(nM) = 2550.0 Kd(nM) = 9300.0