DrugDomain - DB00295

DB00295 Morphine

InChI Key: BQJCRHHNABKAKU-KBQPJGBKSA-N
SMILES: [H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(C)[C@]([H])(C4)[C@]1([H])C=C[C@@H]2O
Small molecule PDB accession : MOI

List of proteins that are targets for DB00295

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P35372_DB00295 P35372 agonist Mu-type opioid receptor Ki(nM) = 0.14
IC50(nM) = 0.57
EC50(nM) = 3.0

2 P41143_DB00295 P41143 agonist Delta-type opioid receptor Ki(nM) = 51.0
IC50(nM) = 10.0
EC50(nM) = 16.0

3 P41145_DB00295 P41145 agonist Kappa-type opioid receptor Ki(nM) = 6.9
IC50(nM) = 217.0
EC50(nM) = 330.0

4 Q9Y6Y9_DB00295 Q9Y6Y9 activator Lymphocyte antigen 96

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P35372_DB00295	P35372	agonist	Mu-type opioid receptor	Ki(nM) = 0.14 IC50(nM) = 0.57 EC50(nM) = 3.0
2	P41143_DB00295	P41143	agonist	Delta-type opioid receptor	Ki(nM) = 51.0 IC50(nM) = 10.0 EC50(nM) = 16.0
3	P41145_DB00295	P41145	agonist	Kappa-type opioid receptor	Ki(nM) = 6.9 IC50(nM) = 217.0 EC50(nM) = 330.0
4	Q9Y6Y9_DB00295	Q9Y6Y9	activator	Lymphocyte antigen 96