DB00308 Ibutilide
InChI Key: ALOBUEHUHMBRLE-UHFFFAOYSA-N
SMILES: CCCCCCCN(CC)CCCC(O)C1=CC=C(NS(C)(=O)=O)C=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB00308
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q02641_DB00308 | Q02641 | activator | Voltage-dependent L-type calcium channel subunit beta-1 | |
2 | P54289_DB00308 | P54289 | activator | Voltage-dependent calcium channel subunit alpha-2/delta-1 | |
3 | Q9NS40_DB00308 | Q9NS40 | inhibitor | Potassium voltage-gated channel subfamily H member 7 | |
4 | Q14654_DB00308 | Q14654 | inhibitor | ATP-sensitive inward rectifier potassium channel 11 | |
5 | O00180_DB00308 | O00180 | inhibitor | Potassium channel subfamily K member 1 | |
6 | Q13936_DB00308 | Q13936 | activator | Voltage-dependent L-type calcium channel subunit alpha-1C | IC50(nM) = 62500.0 |
7 | Q12809_DB00308 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 10.0 |
8 | Q06432_DB00308 | Q06432 | activator | Voltage-dependent calcium channel gamma-1 subunit | |
9 | Q9H252_DB00308 | Q9H252 | inhibitor | Potassium voltage-gated channel subfamily H member 6 | |
10 | Q9Y257_DB00308 | Q9Y257 | inhibitor | Potassium channel subfamily K member 6 |