DB00312 Pentobarbital
InChI Key: WEXRUCMBJFQVBZ-UHFFFAOYSA-N
SMILES: CCCC(C)C1(CC)C(=O)NC(=O)NC1=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB00312
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P48169_DB00312 | P48169 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-4 | |
| 2 | P14867_DB00312 | P14867 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-1 | IC50(nM) = 1000000.0 |
| 3 | P31644_DB00312 | P31644 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-5 | |
| 4 | Q13002_DB00312 | Q13002 | antagonist | Glutamate receptor ionotropic, kainate 2 | |
| 5 | P42262_DB00312 | P42262 | antagonist | Glutamate receptor 2 | |
| 6 | P36544_DB00312 | P36544 | antagonist | Neuronal acetylcholine receptor subunit alpha-7 | |
| 7 | P43681_DB00312 | P43681 | antagonist | Neuronal acetylcholine receptor subunit alpha-4 | |
| 8 | O75469_DB00312 | O75469 | activator | Nuclear receptor subfamily 1 group I member 2 | |
| 9 | P47869_DB00312 | P47869 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-2 | EC50(nM) = 50000.0 |
| 10 | P34903_DB00312 | P34903 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-3 | |
| 11 | Q16445_DB00312 | Q16445 | potentiator | Gamma-aminobutyric acid receptor subunit alpha-6 |