DB00315 Zolmitriptan
InChI Key: ULSDMUVEXKOYBU-ZDUSSCGKSA-N
SMILES: CN(C)CCC1=CNC2=CC=C(C[C@H]3COC(=O)N3)C=C12
Small molecule PDB accession : n/a
List of proteins that are targets for DB00315
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB00315 | P34969 | agonist | 5-hydroxytryptamine receptor 7 | |
2 | P30939_DB00315 | P30939 | agonist | 5-hydroxytryptamine receptor 1F | |
3 | P28566_DB00315 | P28566 | agonist | 5-hydroxytryptamine receptor 1E | |
4 | P28221_DB00315 | P28221 | agonist | 5-hydroxytryptamine receptor 1D | Ki(nM) = 0.76 IC50(nM) = 2.8 Kd(nM) = 1.5 |
5 | P08908_DB00315 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 79.0 Kd(nM) = 1.8 |
6 | P28223_DB00315 | P28223 | agonist | 5-hydroxytryptamine receptor 2A | |
7 | P41595_DB00315 | P41595 | agonist | 5-hydroxytryptamine receptor 2B | |
8 | P28222_DB00315 | P28222 | agonist | 5-hydroxytryptamine receptor 1B | Ki(nM) = 4.2 IC50(nM) = 6.2 Kd(nM) = 1.5 EC50(nM) = 16.0 |