DB00321 Amitriptyline
InChI Key: KRMDCWKBEZIMAB-UHFFFAOYSA-N
SMILES: CN(C)CCC=C1C2=CC=CC=C2CCC2=CC=CC=C12
Small molecule PDB accession : TP0
List of proteins that are targets for DB00321
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB00321 | P35372 | binder | Mu-type opioid receptor | |
2 | P34969_DB00321 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | |
3 | P50406_DB00321 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 65.0 |
4 | P25021_DB00321 | P25021 | blocker | Histamine H2 receptor | |
5 | P28221_DB00321 | P28221 | binder | 5-hydroxytryptamine receptor 1D | |
6 | P08908_DB00321 | P08908 | inhibitor | 5-hydroxytryptamine receptor 1A | Ki(nM) = 450.0 |
7 | P28335_DB00321 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 18.0 |
8 | P28223_DB00321 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | |
9 | O43526_DB00321 | O43526 | inhibitor | Potassium voltage-gated channel subfamily KQT member 2 | |
10 | O43525_DB00321 | O43525 | inhibitor | Potassium voltage-gated channel subfamily KQT member 3 | |
11 | P31645_DB00321 | P31645 | inhibitor | Sodium-dependent serotonin transporter | Ki(nM) = 2.8 |
12 | Q99720_DB00321 | Q99720 | agonist | Sigma non-opioid intracellular receptor 1 | |
13 | P41143_DB00321 | P41143 | agonist | Delta-type opioid receptor | |
14 | P28222_DB00321 | P28222 | binder | 5-hydroxytryptamine receptor 1B | |
15 | P41145_DB00321 | P41145 | agonist | Kappa-type opioid receptor | |
16 | P35367_DB00321 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 0.67 |
17 | P08913_DB00321 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 114.0 |
18 | P04629_DB00321 | P04629 | agonist | High affinity nerve growth factor receptor | IC50(nM) = 60000.0 Kd(nM) = 1800000.0 EC50(nM) = 86000.0 |
19 | Q16620_DB00321 | Q16620 | agonist | BDNF/NT-3 growth factors receptor | |
20 | Q09470_DB00321 | Q09470 | inhibitor | Potassium voltage-gated channel subfamily A member 1 | |
21 | P23975_DB00321 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | Ki(nM) = 13.3 |
22 | P35368_DB00321 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
23 | P35348_DB00321 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 4.4 |
24 | P25100_DB00321 | P25100 | antagonist | Alpha-1D adrenergic receptor | |
25 | Q9H3N8_DB00321 | Q9H3N8 | binder | Histamine H4 receptor | Ki(nM) = 33.6 |