DB00328 Indomethacin
InChI Key: CGIGDMFJXJATDK-UHFFFAOYSA-N
SMILES: COC1=CC2=C(C=C1)N(C(=O)C1=CC=C(Cl)C=C1)C(C)=C2CC(O)=O
Small molecule PDB accession : IMN
List of proteins that are targets for DB00328
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P23219_DB00328 | P23219 | inhibitor | Prostaglandin G/H synthase 1 | Ki(nM) = 13.0 IC50(nM) = 2.0 Kd(nM) = 253.0 |
2 | Q9Y5Y4_DB00328 | Q9Y5Y4 | other/unknown | Prostaglandin D2 receptor 2 | Ki(nM) = 50.0 EC50(nM) = 389.0 |
3 | P35354_DB00328 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | Ki(nM) = 130.0 IC50(nM) = 5.9 Kd(nM) = 92.0 |
4 | Q8N8N7_DB00328 | Q8N8N7 | inhibitor | Prostaglandin reductase 2 | |
5 | P42330_DB00328 | P42330 | inhibitor | Aldo-keto reductase family 1 member C3 | Ki(nM) = 270.0 IC50(nM) = 100.0 |
6 | P19525_DB00328 | P19525 | inducer | Interferon-induced, double-stranded RNA-activated protein kinase | |
7 | Q07869_DB00328 | Q07869 | agonist | Peroxisome proliferator-activated receptor alpha | |
8 | P37231_DB00328 | P37231 | activator | Peroxisome proliferator-activated receptor gamma | EC50(nM) = 50000.0 |
9 | Q04760_DB00328 | Q04760 | inhibitor | Lactoylglutathione lyase | Ki(nM) = 18100.0 |
10 | P14555_DB00328 | P14555 | inhibitor | Phospholipase A2, membrane associated |