DB00334 Olanzapine
InChI Key: KVWDHTXUZHCGIO-UHFFFAOYSA-N
SMILES: CN1CCN(CC1)C1=NC2=CC=CC=C2NC2=C1C=C(C)S2
Small molecule PDB accession : n/a
List of proteins that are targets for DB00334
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P21918_DB00334 | P21918 | antagonist | D | |
2 | P50406_DB00334 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 5.0 |
3 | P21728_DB00334 | P21728 | antagonist | D | Ki(nM) = 10.0 |
4 | P28335_DB00334 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 2.8 IC50(nM) = 71.0 |
5 | P28223_DB00334 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.42 IC50(nM) = 7.0 |
6 | P21917_DB00334 | P21917 | antagonist | D | Ki(nM) = 20.0 IC50(nM) = 173.0 |
7 | P08173_DB00334 | P08173 | antagonist | Muscarinic acetylcholine receptor M4 | Ki(nM) = 13.0 |
8 | P11229_DB00334 | P11229 | antagonist | Muscarinic acetylcholine receptor M1 | Ki(nM) = 2.1 EC50(nM) = 100000.0 |
9 | P14416_DB00334 | P14416 | antagonist | D | Ki(nM) = 2.1 IC50(nM) = 10.0 |
10 | P08172_DB00334 | P08172 | antagonist | Muscarinic acetylcholine receptor M2 | |
11 | P35367_DB00334 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 1.2 Kd(nM) = 0.087 |
12 | P35462_DB00334 | P35462 | antagonist | D | Ki(nM) = 20.0 |
13 | P20309_DB00334 | P20309 | antagonist | Muscarinic acetylcholine receptor M3 | Ki(nM) = 26.0 |
14 | P35368_DB00334 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
15 | P35348_DB00334 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 15.0 |
16 | P46098_DB00334 | P46098 | antagonist | 5-hydroxytryptamine receptor 3A |