DB00393 Nimodipine
InChI Key: UIAGMCDKSXEBJQ-UHFFFAOYSA-N
SMILES: COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C
Small molecule PDB accession : n/a
List of proteins that are targets for DB00393
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q02641_DB00393 | Q02641 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-1 | |
| 2 | P54284_DB00393 | P54284 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-3 | |
| 3 | P35869_DB00393 | P35869 | agonist | Aryl hydrocarbon receptor | |
| 4 | Q01668_DB00393 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
| 5 | Q13698_DB00393 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
| 6 | O00305_DB00393 | O00305 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-4 | |
| 7 | P08235_DB00393 | P08235 | antagonist | Mineralocorticoid receptor | |
| 8 | Q13936_DB00393 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | IC50(nM) = 110.0 |
| 9 | Q08289_DB00393 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 | IC50(nM) = 30.0 |
| 10 | O60840_DB00393 | O60840 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1F | IC50(nM) = 14000.0 |